ChemNet > CAS > 342002-80-6 3-Borono-Benzoic acid 1-(1-methylethyl) ester
342002-80-6 3-Borono-Benzoic acid 1-(1-methylethyl) ester
Naam product |
3-Borono-Benzoic acid 1-(1-methylethyl) ester |
Synoniemen |
3-Isopropoxycarbonylphenylboronic acid; {3-[(1-methylethoxy)carbonyl]phenyl}boronic acid; 4-(2H-tetrazol-5-yl)benzaldehyde |
MF |
C8H6N4O |
Molecuulgewicht |
174.1594 |
InChI |
InChI=1/C8H6N4O/c13-5-6-1-3-7(4-2-6)8-9-11-12-10-8/h1-5H,(H,9,10,11,12) |
CAS-nummer |
342002-80-6 |
Moleculaire Structuur |
|
Dichtheid |
1.4g/cm3 |
Kookpunt |
409°C at 760 mmHg |
Brekingsindex |
1.667 |
Vlampunt |
203.2°C |
Gevaarsymbolen |
Xi:Irritant;
|
Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|